heptyl heptanoate


enanthic acid heptyl ester; heptyl enanthate; heptyl heptanoate; heptyl heptoate; n-heptyl n-heptylate; heptyl oenanthylate
CAS RN:[624-09-9]
Formula:C14H28O2; 228.38 g/mol
InChiKey:QOIIBPAJVWFEPE-UHFFFAOYSA-N
SMILES:CCCCCCCOC(=O)CCCCCC
Molecular structure of heptyl heptanoate
Density:0.865 g/mL
Molar volume:264.0 mL/mol
Refractive index:1.432
Molecular refractive power:68.45 mL/mol
Melting point:-33 °C
Boiling point:274 °C

Isomers

trans-1-[(2-tert-butylcyclohexyl)oxy]butan-2-ol
Molecular structure of trans-1-[(2-tert-butylcyclohexyl)oxy]butan-2-ol
butyl decanoate
Molecular structure of butyl decanoate
decyl butanoate
Molecular structure of decyl butanoate
1,1-dimethoxycyclododecane
Molecular structure of 1,1-dimethoxycyclododecane
dodecyl acetate
Molecular structure of dodecyl acetate
ethyl dodecanoate
Molecular structure of ethyl dodecanoate
heptyl heptanoate
Molecular structure of heptyl heptanoate
hexyl octanoate
Molecular structure of hexyl octanoate
3-methylbutyl nonanoate
Molecular structure of 3-methylbutyl nonanoate
methyl tridecanoate
Molecular structure of methyl tridecanoate
octyl hexanoate
Molecular structure of octyl hexanoate
pentyl nonanoate
Molecular structure of pentyl nonanoate
tetradecanoic acid
Molecular structure of tetradecanoic acid